C23H33N7O — CID 5186546
4,6-bis(azepan-1-yl)-N-[(4-methoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine (PubChem CID 5186546) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 4,6-bis(azepan-1-yl)-N-[(4-methoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(azepan-1-yl)-N-[(4-methoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5186546 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 4,6-bis(azepan-1-yl)-N-[(4-methoxyphenyl)methylideneamino]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(C=NNc2nc(N3CCCCCC3)nc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H33N7O/c1-31-20-12-10-19(11-13-20)18-24-28-21-25-22(29-14-6-2-3-7-15-29)27-23(26-21)30-16-8-4-5-9-17-30/h10-13,18H,2-9,14-17H2,1H3,(H,25,26,27,28) |
| InChIKey | PXAKJPMVIFVIER-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|