C32H43N7O3 — CID 5146690
N-[[4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 5146690) has the molecular formula C32H43N7O3 and a molecular weight of 573.74 g/mol. Its IUPAC name is N-[[4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[[4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5146690 |
| Molecular Formula | C32H43N7O3 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | N-[[4-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCOc1ccc(OCCOc2ccc(C=NNc3nc(N4CCCC4)nc(N4CCCC4)n3)cc2)cc1 |
| InChI | InChI=1S/C32H43N7O3/c1-2-3-4-9-22-40-28-14-16-29(17-15-28)42-24-23-41-27-12-10-26(11-13-27)25-33-37-30-34-31(38-18-5-6-19-38)36-32(35-30)39-20-7-8-21-39/h10-17,25H,2-9,18-24H2,1H3,(H,34,35,36,37) |
| InChIKey | SQIOMIKJCDDZRT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|