C28H35N7O2 — CID 3871762
N-[[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 3871762) has the molecular formula C28H35N7O2 and a molecular weight of 501.64 g/mol. Its IUPAC name is N-[[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3871762 |
| Molecular Formula | C28H35N7O2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-[[4-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(OCCOc2ccc(C=NNc3nc(N4CCCC4)nc(N4CCCC4)n3)cc2)cc1C |
| InChI | InChI=1S/C28H35N7O2/c1-21-7-10-25(19-22(21)2)37-18-17-36-24-11-8-23(9-12-24)20-29-33-26-30-27(34-13-3-4-14-34)32-28(31-26)35-15-5-6-16-35/h7-12,19-20H,3-6,13-18H2,1-2H3,(H,30,31,32,33) |
| InChIKey | SULRAKBZDXYRCR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|