C20H27N7O4 — CID 2848777
N-[(3,5-dimethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 2848777) has the molecular formula C20H27N7O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 2848777 |
| Molecular Formula | C20H27N7O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1cc(C=NNc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc(OC)c1 |
| InChI | InChI=1S/C20H27N7O4/c1-28-16-11-15(12-17(13-16)29-2)14-21-25-18-22-19(26-3-7-30-8-4-26)24-20(23-18)27-5-9-31-10-6-27/h11-14H,3-10H2,1-2H3,(H,22,23,24,25) |
| InChIKey | HQLPJHUZNFIAEM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|