C16H15N3O2 — CID 6054346
2-[2-methoxy-4-[(Z)-(phenylhydrazinylidene)methyl]phenoxy]acetonitrile (PubChem CID 6054346) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-(phenylhydrazinylidene)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-4-[(Z)-(phenylhydrazinylidene)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 6054346 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-(phenylhydrazinylidene)methyl]phenoxy]acetonitrile |
| SMILES | COc1cc(/C=N\Nc2ccccc2)ccc1OCC#N |
| InChI | InChI=1S/C16H15N3O2/c1-20-16-11-13(7-8-15(16)21-10-9-17)12-18-19-14-5-3-2-4-6-14/h2-8,11-12,19H,10H2,1H3/b18-12- |
| InChIKey | ACYZCDAIBWNFCM-PDGQHHTCSA-N |
| XLogP | 3.04 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|