C15H15Cl2N7O4 — CID 3098944
N-[(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 3098944) has the molecular formula C15H15Cl2N7O4 and a molecular weight of 428.24 g/mol. Its IUPAC name is N-[(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3098944 |
| Molecular Formula | C15H15Cl2N7O4 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | N-[(2,4-dichloro-5-nitrophenyl)methylideneamino]-4-methoxy-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN=Cc2cc([N+](=O)[O-])c(Cl)cc2Cl)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H15Cl2N7O4/c1-27-15-20-13(19-14(21-15)23-2-4-28-5-3-23)22-18-8-9-6-12(24(25)26)11(17)7-10(9)16/h6-8H,2-5H2,1H3,(H,19,20,21,22) |
| InChIKey | POUNEPPICHCMLN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 127.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|