C26H30N8O4 — CID 136844832
4-benzyl-2-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 136844832) has the molecular formula C26H30N8O4 and a molecular weight of 518.58 g/mol. Its IUPAC name is 4-benzyl-2-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 4-benzyl-2-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 136844832 |
| Molecular Formula | C26H30N8O4 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-benzyl-2-[(Z)-[(4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cc2ccccc2)cc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C26H30N8O4/c35-23-21(16-20(17-22(23)34(36)37)15-19-7-3-1-4-8-19)18-27-31-24-28-25(32-9-5-2-6-10-32)30-26(29-24)33-11-13-38-14-12-33/h1,3-4,7-8,16-18,35H,2,5-6,9-15H2,(H,28,29,30,31)/b27-18- |
| InChIKey | XDCWPCDLNGEYEU-IMRQLAEWSA-N |
| XLogP | 3.35 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|