C25H28N8O3 — CID 171132218
4-benzyl-2-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 171132218) has the molecular formula C25H28N8O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 4-benzyl-2-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 4-benzyl-2-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 171132218 |
| Molecular Formula | C25H28N8O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-benzyl-2-[[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cc2ccccc2)cc(C=NNc2nc(N3CCCC3)nc(N3CCCC3)n2)c1O |
| InChI | InChI=1S/C25H28N8O3/c34-22-20(15-19(16-21(22)33(35)36)14-18-8-2-1-3-9-18)17-26-30-23-27-24(31-10-4-5-11-31)29-25(28-23)32-12-6-7-13-32/h1-3,8-9,15-17,34H,4-7,10-14H2,(H,27,28,29,30) |
| InChIKey | OGUSAEUIOLKVEI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|