C20H20N8O3 — CID 135479251
2-[(E)-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 135479251) has the molecular formula C20H20N8O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-[(E)-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[(E)-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135479251 |
| Molecular Formula | C20H20N8O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[(E)-[(4-anilino-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/Nc2nc(Nc3ccccc3)nc(N3CCCC3)n2)c1O |
| InChI | InChI=1S/C20H20N8O3/c29-17-14(7-6-10-16(17)28(30)31)13-21-26-19-23-18(22-15-8-2-1-3-9-15)24-20(25-19)27-11-4-5-12-27/h1-3,6-10,13,29H,4-5,11-12H2,(H2,22,23,24,25,26)/b21-13+ |
| InChIKey | NTEMWCNRCJBYNZ-FYJGNVAPSA-N |
| XLogP | 3.28 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|