C23H20N8O4 — CID 136878215
2-[(Z)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 136878215) has the molecular formula C23H20N8O4 and a molecular weight of 472.47 g/mol. Its IUPAC name is 2-[(Z)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[(Z)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 136878215 |
| Molecular Formula | C23H20N8O4 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-[(Z)-[[4-anilino-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | COc1ccc(Nc2nc(N/N=C\c3cccc([N+](=O)[O-])c3O)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H20N8O4/c1-35-18-12-10-17(11-13-18)26-22-27-21(25-16-7-3-2-4-8-16)28-23(29-22)30-24-14-15-6-5-9-19(20(15)32)31(33)34/h2-14,32H,1H3,(H3,25,26,27,28,29,30)/b24-14- |
| InChIKey | UKPSNGZENCVVKE-OYKKKHCWSA-N |
| XLogP | 4.43 |
| TPSA | 159.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|