C29H31ClN8O3 — CID 163330785
2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol;hydrochloride (PubChem CID 163330785) has the molecular formula C29H31ClN8O3 and a molecular weight of 575.07 g/mol. Its IUPAC name is 2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol;hydrochloride.
| Compound Name | 2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 163330785 |
| Molecular Formula | C29H31ClN8O3 |
| Molecular Weight | 575.07 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol;hydrochloride |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3cccc([N+](=O)[O-])c3O)nc(N3CCC(Cc4ccccc4)CC3)n2)cc1.Cl |
| InChI | InChI=1S/C29H30N8O3.ClH/c1-20-10-12-24(13-11-20)31-27-32-28(35-30-19-23-8-5-9-25(26(23)38)37(39)40)34-29(33-27)36-16-14-22(15-17-36)18-21-6-3-2-4-7-21;/h2-13,19,22,38H,14-18H2,1H3,(H2,31,32,33,34,35);1H/b30-19+; |
| InChIKey | JUUOSNZEYCHHOV-QUIZVCAPSA-N |
| XLogP | 5.86 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.07 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|