C30H31BrN8O5 — CID 137059965
4-[(Z)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-2-methoxy-3-nitrophenol (PubChem CID 137059965) has the molecular formula C30H31BrN8O5 and a molecular weight of 663.53 g/mol. Its IUPAC name is 4-[(Z)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-2-methoxy-3-nitrophenol.
| Compound Name | 4-[(Z)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-2-methoxy-3-nitrophenol |
|---|---|
| PubChem CID | 137059965 |
| Molecular Formula | C30H31BrN8O5 |
| Molecular Weight | 663.53 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | 4-[(Z)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-bromo-2-methoxy-3-nitrophenol |
| SMILES | COc1ccc(Nc2nc(N/N=C\c3cc(Br)c(O)c(OC)c3[N+](=O)[O-])nc(N3CCC(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C30H31BrN8O5/c1-43-23-10-8-22(9-11-23)33-28-34-29(37-32-18-21-17-24(31)26(40)27(44-2)25(21)39(41)42)36-30(35-28)38-14-12-20(13-15-38)16-19-6-4-3-5-7-19/h3-11,17-18,20,40H,12-16H2,1-2H3,(H2,33,34,35,36,37)/b32-18- |
| InChIKey | AOBABZYLPILJGY-CAQPMQTCSA-N |
| XLogP | 5.91 |
| TPSA | 160.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|