C23H20BrN7O2 — CID 3101860
6-bromo-3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 3101860) has the molecular formula C23H20BrN7O2 and a molecular weight of 506.36 g/mol. Its IUPAC name is 6-bromo-3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 6-bromo-3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 3101860 |
| Molecular Formula | C23H20BrN7O2 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 6-bromo-3-[[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1c(C=NNc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)ccc(Br)c1O |
| InChI | InChI=1S/C23H20BrN7O2/c1-33-20-15(12-13-18(24)19(20)32)14-25-31-23-29-21(26-16-8-4-2-5-9-16)28-22(30-23)27-17-10-6-3-7-11-17/h2-14,32H,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | QWRKWUOADNKTBF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|