C22H17Br2N7O2 — CID 136680616
2,4-dibromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 136680616) has the molecular formula C22H17Br2N7O2 and a molecular weight of 571.23 g/mol. Its IUPAC name is 2,4-dibromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 2,4-dibromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136680616 |
| Molecular Formula | C22H17Br2N7O2 |
| Molecular Weight | 571.23 g/mol |
| Exact Mass | 568.98 |
| IUPAC Name | 2,4-dibromo-6-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | Oc1c(Br)cc(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c(O)c1Br |
| InChI | InChI=1S/C22H17Br2N7O2/c23-16-11-13(18(32)17(24)19(16)33)12-25-31-22-29-20(26-14-7-3-1-4-8-14)28-21(30-22)27-15-9-5-2-6-10-15/h1-12,32-33H,(H3,26,27,28,29,30,31)/b25-12- |
| InChIKey | MZYLNJPTBWJDKN-ROTLSHHCSA-N |
| XLogP | 5.74 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.23 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|