C29H29N9O5 — CID 135479735
2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol (PubChem CID 135479735) has the molecular formula C29H29N9O5 and a molecular weight of 583.61 g/mol. Its IUPAC name is 2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol.
| Compound Name | 2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 135479735 |
| Molecular Formula | C29H29N9O5 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 2-[(E)-[[4-(4-benzylpiperidin-1-yl)-6-(4-methylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4,6-dinitrophenol |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)nc(N3CCC(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C29H29N9O5/c1-19-7-9-23(10-8-19)31-27-32-28(35-30-18-22-16-24(37(40)41)17-25(26(22)39)38(42)43)34-29(33-27)36-13-11-21(12-14-36)15-20-5-3-2-4-6-20/h2-10,16-18,21,39H,11-15H2,1H3,(H2,31,32,33,34,35)/b30-18+ |
| InChIKey | RFHHIDGTVPLCNA-UXHLAJHPSA-N |
| XLogP | 5.35 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|