C22H24N8O3 — CID 6104081
2-N-[(Z)-(2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 6104081) has the molecular formula C22H24N8O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-N-[(Z)-(2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-(2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6104081 |
| Molecular Formula | C22H24N8O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-N-[(Z)-(2-methoxyphenyl)methylideneamino]-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccccc1/C=N\Nc1nc(Nc2ccc([N+](=O)[O-])cc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C22H24N8O3/c1-33-19-8-4-3-7-16(19)15-23-28-21-25-20(24-17-9-11-18(12-10-17)30(31)32)26-22(27-21)29-13-5-2-6-14-29/h3-4,7-12,15H,2,5-6,13-14H2,1H3,(H2,24,25,26,27,28)/b23-15- |
| InChIKey | JAMCJTNBFKNQSV-HAHDFKILSA-N |
| XLogP | 3.97 |
| TPSA | 130.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|