C23H23N9O2 — CID 136832231
2-N-(1H-indol-3-ylmethylideneamino)-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 136832231) has the molecular formula C23H23N9O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-N-(1H-indol-3-ylmethylideneamino)-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1H-indol-3-ylmethylideneamino)-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 136832231 |
| Molecular Formula | C23H23N9O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-N-(1H-indol-3-ylmethylideneamino)-4-N-(4-nitrophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(NN=Cc3c[nH]c4ccccc34)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H23N9O2/c33-32(34)18-10-8-17(9-11-18)26-21-27-22(29-23(28-21)31-12-4-1-5-13-31)30-25-15-16-14-24-20-7-3-2-6-19(16)20/h2-3,6-11,14-15,24H,1,4-5,12-13H2,(H2,26,27,28,29,30) |
| InChIKey | UTHLGIFAIPXDAU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|