C20H19BrClN7O2 — CID 135909987
4-bromo-2-[(Z)-[[4-(4-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 135909987) has the molecular formula C20H19BrClN7O2 and a molecular weight of 504.78 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[[4-(4-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[(Z)-[[4-(4-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135909987 |
| Molecular Formula | C20H19BrClN7O2 |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 4-bromo-2-[(Z)-[[4-(4-chloroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccc(Br)cc1/C=N\Nc1nc(Nc2ccc(Cl)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H19BrClN7O2/c21-14-1-6-17(30)13(11-14)12-23-28-19-25-18(24-16-4-2-15(22)3-5-16)26-20(27-19)29-7-9-31-10-8-29/h1-6,11-12,30H,7-10H2,(H2,24,25,26,27,28)/b23-12- |
| InChIKey | DFOUOAGHZGLVGF-FMCGGJTJSA-N |
| XLogP | 4.02 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|