C26H23Cl2N9O2 — CID 137059894
2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol (PubChem CID 137059894) has the molecular formula C26H23Cl2N9O2 and a molecular weight of 564.44 g/mol. Its IUPAC name is 2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol.
| Compound Name | 2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 137059894 |
| Molecular Formula | C26H23Cl2N9O2 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[(Z)-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol |
| SMILES | Oc1ccc(/N=N/c2ccc(Cl)cc2Cl)cc1/C=N\Nc1nc(Nc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C26H23Cl2N9O2/c27-18-6-8-22(21(28)15-18)35-34-20-7-9-23(38)17(14-20)16-29-36-25-31-24(30-19-4-2-1-3-5-19)32-26(33-25)37-10-12-39-13-11-37/h1-9,14-16,38H,10-13H2,(H2,30,31,32,33,36)/b29-16-,35-34+ |
| InChIKey | ZGYAKZDPJVNPMI-QUOPWRQUSA-N |
| XLogP | 6.33 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|