C28H21Cl2N9O — CID 136803603
2-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol (PubChem CID 136803603) has the molecular formula C28H21Cl2N9O and a molecular weight of 570.44 g/mol. Its IUPAC name is 2-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol.
| Compound Name | 2-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 136803603 |
| Molecular Formula | C28H21Cl2N9O |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 2-[(Z)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-4-[(2,4-dichlorophenyl)diazenyl]phenol |
| SMILES | Oc1ccc(/N=N/c2ccc(Cl)cc2Cl)cc1/C=N\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C28H21Cl2N9O/c29-19-11-13-24(23(30)16-19)38-37-22-12-14-25(40)18(15-22)17-31-39-28-35-26(32-20-7-3-1-4-8-20)34-27(36-28)33-21-9-5-2-6-10-21/h1-17,40H,(H3,32,33,34,35,36,39)/b31-17-,38-37+ |
| InChIKey | LGOUUVNCGDKPSP-QLUZVCPISA-N |
| XLogP | 8.23 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|