C23H24Br3N7O5 — CID 146051337
acetic acid;2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 146051337) has the molecular formula C23H24Br3N7O5 and a molecular weight of 718.20 g/mol. Its IUPAC name is acetic acid;2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | acetic acid;2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 146051337 |
| Molecular Formula | C23H24Br3N7O5 |
| Molecular Weight | 718.20 g/mol |
| Exact Mass | 714.94 |
| IUPAC Name | acetic acid;2,4-dibromo-6-[(E)-[[4-(2-bromo-4-methylanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | CC(=O)O.Cc1ccc(Nc2nc(N/N=C/c3cc(Br)c(O)c(Br)c3O)nc(N3CCOCC3)n2)c(Br)c1 |
| InChI | InChI=1S/C21H20Br3N7O3.C2H4O2/c1-11-2-3-15(13(22)8-11)26-19-27-20(29-21(28-19)31-4-6-34-7-5-31)30-25-10-12-9-14(23)18(33)16(24)17(12)32;1-2(3)4/h2-3,8-10,32-33H,4-7H2,1H3,(H2,26,27,28,29,30);1H3,(H,3,4)/b25-10+; |
| InChIKey | UQSRAVMTIHZLLF-LPFBMCEESA-N |
| XLogP | 5.00 |
| TPSA | 165.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.20 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|