C29H28Br2Cl3N7O2 — CID 91962128
2-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride (PubChem CID 91962128) has the molecular formula C29H28Br2Cl3N7O2 and a molecular weight of 772.76 g/mol. Its IUPAC name is 2-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 91962128 |
| Molecular Formula | C29H28Br2Cl3N7O2 |
| Molecular Weight | 772.76 g/mol |
| Exact Mass | 768.97 |
| IUPAC Name | 2-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N-(2,5-dimethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(C)c(Nc2nc(NN=Cc3cc(Br)cc(Br)c3OCc3ccc(Cl)cc3Cl)nc(N3CCOCC3)n2)c1.Cl |
| InChI | InChI=1S/C29H27Br2Cl2N7O2.ClH/c1-17-3-4-18(2)25(11-17)35-27-36-28(38-29(37-27)40-7-9-41-10-8-40)39-34-15-20-12-21(30)13-23(31)26(20)42-16-19-5-6-22(32)14-24(19)33;/h3-6,11-15H,7-10,16H2,1-2H3,(H2,35,36,37,38,39);1H |
| InChIKey | HILWCROKFBLRCP-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.76 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|