C28H26Br2Cl3N7O — CID 3103682
6-N-(3-chloro-4-methylphenyl)-4-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 3103682) has the molecular formula C28H26Br2Cl3N7O and a molecular weight of 742.73 g/mol. Its IUPAC name is 6-N-(3-chloro-4-methylphenyl)-4-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(3-chloro-4-methylphenyl)-4-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3103682 |
| Molecular Formula | C28H26Br2Cl3N7O |
| Molecular Weight | 742.73 g/mol |
| Exact Mass | 738.96 |
| IUPAC Name | 6-N-(3-chloro-4-methylphenyl)-4-N-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(NN=Cc2cc(Br)cc(Br)c2OCc2ccc(Cl)cc2Cl)nc(Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C28H26Br2Cl3N7O/c1-4-40(5-2)28-37-26(35-21-9-6-16(3)23(32)13-21)36-27(38-28)39-34-14-18-10-19(29)11-22(30)25(18)41-15-17-7-8-20(31)12-24(17)33/h6-14H,4-5,15H2,1-3H3,(H2,35,36,37,38,39) |
| InChIKey | JRMRVEXTJUORKF-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|