C14H9Br3Cl2O — CID 107745761
1,3-dibromo-5-(bromomethyl)-2-[(2,4-dichlorophenyl)methoxy]benzene (PubChem CID 107745761) has the molecular formula C14H9Br3Cl2O and a molecular weight of 503.84 g/mol. Its IUPAC name is 1,3-dibromo-5-(bromomethyl)-2-[(2,4-dichlorophenyl)methoxy]benzene.
| Compound Name | 1,3-dibromo-5-(bromomethyl)-2-[(2,4-dichlorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 107745761 |
| Molecular Formula | C14H9Br3Cl2O |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 499.76 |
| IUPAC Name | 1,3-dibromo-5-(bromomethyl)-2-[(2,4-dichlorophenyl)methoxy]benzene |
| SMILES | Clc1ccc(COc2c(Br)cc(CBr)cc2Br)c(Cl)c1 |
| InChI | InChI=1S/C14H9Br3Cl2O/c15-6-8-3-11(16)14(12(17)4-8)20-7-9-1-2-10(18)5-13(9)19/h1-5H,6-7H2 |
| InChIKey | GDEJXWGPOBDMPG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|