C21H17Br2Cl2NO2 — CID 126116346
N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline (PubChem CID 126116346) has the molecular formula C21H17Br2Cl2NO2 and a molecular weight of 546.09 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline.
| Compound Name | N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 126116346 |
| Molecular Formula | C21H17Br2Cl2NO2 |
| Molecular Weight | 546.09 g/mol |
| Exact Mass | 542.90 |
| IUPAC Name | N-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c2)cc1 |
| InChI | InChI=1S/C21H17Br2Cl2NO2/c1-27-17-6-4-16(5-7-17)26-11-13-8-18(22)21(19(23)9-13)28-12-14-2-3-15(24)10-20(14)25/h2-10,26H,11-12H2,1H3 |
| InChIKey | PQOZAIINRLHSTI-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.09 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|