C24H24Cl3NO3 — CID 126127578
N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethoxyaniline (PubChem CID 126127578) has the molecular formula C24H24Cl3NO3 and a molecular weight of 480.82 g/mol. Its IUPAC name is N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126127578 |
| Molecular Formula | C24H24Cl3NO3 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-[[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2cc(Cl)c(OCc3ccc(Cl)cc3Cl)c(OCC)c2)cc1 |
| InChI | InChI=1S/C24H24Cl3NO3/c1-3-29-20-9-7-19(8-10-20)28-14-16-11-22(27)24(23(12-16)30-4-2)31-15-17-5-6-18(25)13-21(17)26/h5-13,28H,3-4,14-15H2,1-2H3 |
| InChIKey | UGQFGTMYVPIMGZ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|