C27H26ClNO3 — CID 126116410
N-[[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-4-ethoxyaniline (PubChem CID 126116410) has the molecular formula C27H26ClNO3 and a molecular weight of 447.96 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126116410 |
| Molecular Formula | C27H26ClNO3 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2cc(Cl)c(OCc3cccc4ccccc34)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H26ClNO3/c1-3-31-23-13-11-22(12-14-23)29-17-19-15-25(28)27(26(16-19)30-2)32-18-21-9-6-8-20-7-4-5-10-24(20)21/h4-16,29H,3,17-18H2,1-2H3 |
| InChIKey | QZSXBXRUDZJNPM-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|