C27H23Cl2NO3 — CID 126121340
N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenoxyaniline (PubChem CID 126121340) has the molecular formula C27H23Cl2NO3 and a molecular weight of 480.39 g/mol. Its IUPAC name is N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenoxyaniline.
| Compound Name | N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenoxyaniline |
|---|---|
| PubChem CID | 126121340 |
| Molecular Formula | C27H23Cl2NO3 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenoxyaniline |
| SMILES | COc1cc(CNc2ccc(Oc3ccccc3)cc2)cc(Cl)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H23Cl2NO3/c1-31-26-16-20(15-25(29)27(26)32-18-19-6-5-7-21(28)14-19)17-30-22-10-12-24(13-11-22)33-23-8-3-2-4-9-23/h2-16,30H,17-18H2,1H3 |
| InChIKey | JPNFMDMTDRPXCW-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |