C26H20Br2ClNO2 — CID 126118175
N-[[3,5-dibromo-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-phenoxyaniline (PubChem CID 126118175) has the molecular formula C26H20Br2ClNO2 and a molecular weight of 573.71 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-phenoxyaniline.
| Compound Name | N-[[3,5-dibromo-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-phenoxyaniline |
|---|---|
| PubChem CID | 126118175 |
| Molecular Formula | C26H20Br2ClNO2 |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 570.95 |
| IUPAC Name | N-[[3,5-dibromo-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-phenoxyaniline |
| SMILES | Clc1cccc(COc2c(Br)cc(CNc3ccc(Oc4ccccc4)cc3)cc2Br)c1 |
| InChI | InChI=1S/C26H20Br2ClNO2/c27-24-14-19(15-25(28)26(24)31-17-18-5-4-6-20(29)13-18)16-30-21-9-11-23(12-10-21)32-22-7-2-1-3-8-22/h1-15,30H,16-17H2 |
| InChIKey | DITHADGGKVDVDK-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |