C24H25BrClNO2 — CID 126128844
N-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethylaniline (PubChem CID 126128844) has the molecular formula C24H25BrClNO2 and a molecular weight of 474.83 g/mol. Its IUPAC name is N-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethylaniline.
| Compound Name | N-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethylaniline |
|---|---|
| PubChem CID | 126128844 |
| Molecular Formula | C24H25BrClNO2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-ethylaniline |
| SMILES | CCOc1cc(CNc2ccc(CC)cc2)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H25BrClNO2/c1-3-17-8-10-21(11-9-17)27-15-19-13-22(25)24(23(14-19)28-4-2)29-16-18-6-5-7-20(26)12-18/h5-14,27H,3-4,15-16H2,1-2H3 |
| InChIKey | ZGRIRIDDIAJUHU-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |