C22H21Cl2NO — CID 126121126
N-[[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-ethylaniline (PubChem CID 126121126) has the molecular formula C22H21Cl2NO and a molecular weight of 386.32 g/mol. Its IUPAC name is N-[[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-ethylaniline.
| Compound Name | N-[[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-ethylaniline |
|---|---|
| PubChem CID | 126121126 |
| Molecular Formula | C22H21Cl2NO |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[[3-chloro-4-[(3-chlorophenyl)methoxy]phenyl]methyl]-4-ethylaniline |
| SMILES | CCc1ccc(NCc2ccc(OCc3cccc(Cl)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H21Cl2NO/c1-2-16-6-9-20(10-7-16)25-14-17-8-11-22(21(24)13-17)26-15-18-4-3-5-19(23)12-18/h3-13,25H,2,14-15H2,1H3 |
| InChIKey | QJEMOOGOJQKEBI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |