C21H19Cl3FNO2 — CID 163326279
N-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline;hydrochloride (PubChem CID 163326279) has the molecular formula C21H19Cl3FNO2 and a molecular weight of 442.75 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline;hydrochloride.
| Compound Name | N-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline;hydrochloride |
|---|---|
| PubChem CID | 163326279 |
| Molecular Formula | C21H19Cl3FNO2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | N-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methyl]-4-methoxyaniline;hydrochloride |
| SMILES | COc1ccc(NCc2cc(Cl)c(OCc3ccccc3F)c(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C21H18Cl2FNO2.ClH/c1-26-17-8-6-16(7-9-17)25-12-14-10-18(22)21(19(23)11-14)27-13-15-4-2-3-5-20(15)24;/h2-11,25H,12-13H2,1H3;1H |
| InChIKey | DWGKPECKAXBDAR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|