C21H17Cl2FINO2 — CID 126204732
3,4-dichloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline (PubChem CID 126204732) has the molecular formula C21H17Cl2FINO2 and a molecular weight of 532.18 g/mol. Its IUPAC name is 3,4-dichloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline.
| Compound Name | 3,4-dichloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 126204732 |
| Molecular Formula | C21H17Cl2FINO2 |
| Molecular Weight | 532.18 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | 3,4-dichloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]aniline |
| SMILES | COc1cc(CNc2ccc(Cl)c(Cl)c2)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C21H17Cl2FINO2/c1-27-20-9-13(11-26-15-6-7-16(22)17(23)10-15)8-19(25)21(20)28-12-14-4-2-3-5-18(14)24/h2-10,26H,11-12H2,1H3 |
| InChIKey | BKZVVNYLZVCKSN-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.18 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|