C17H16Cl2INO2 — CID 126205139
3,4-dichloro-N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methyl]aniline (PubChem CID 126205139) has the molecular formula C17H16Cl2INO2 and a molecular weight of 464.13 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methyl]aniline.
| Compound Name | 3,4-dichloro-N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 126205139 |
| Molecular Formula | C17H16Cl2INO2 |
| Molecular Weight | 464.13 g/mol |
| Exact Mass | 462.96 |
| IUPAC Name | 3,4-dichloro-N-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methyl]aniline |
| SMILES | C=CCOc1c(I)cc(CNc2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C17H16Cl2INO2/c1-3-6-23-17-15(20)7-11(8-16(17)22-2)10-21-12-4-5-13(18)14(19)9-12/h3-5,7-9,21H,1,6,10H2,2H3 |
| InChIKey | MMFKMCZXCBGOHJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.13 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|