C16H15Cl2NO — CID 40603028
3,4-dichloro-N-[(4-prop-2-enoxyphenyl)methyl]aniline (PubChem CID 40603028) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is 3,4-dichloro-N-[(4-prop-2-enoxyphenyl)methyl]aniline.
| Compound Name | 3,4-dichloro-N-[(4-prop-2-enoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 40603028 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3,4-dichloro-N-[(4-prop-2-enoxyphenyl)methyl]aniline |
| SMILES | C=CCOc1ccc(CNc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-2-9-20-14-6-3-12(4-7-14)11-19-13-5-8-15(17)16(18)10-13/h2-8,10,19H,1,9,11H2 |
| InChIKey | ILKDNSMEPBPFQZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|