C16H14BrCl2NO — CID 126201034
N-[(5-bromo-2-prop-2-enoxyphenyl)methyl]-3,4-dichloroaniline (PubChem CID 126201034) has the molecular formula C16H14BrCl2NO and a molecular weight of 387.10 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-enoxyphenyl)methyl]-3,4-dichloroaniline.
| Compound Name | N-[(5-bromo-2-prop-2-enoxyphenyl)methyl]-3,4-dichloroaniline |
|---|---|
| PubChem CID | 126201034 |
| Molecular Formula | C16H14BrCl2NO |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | N-[(5-bromo-2-prop-2-enoxyphenyl)methyl]-3,4-dichloroaniline |
| SMILES | C=CCOc1ccc(Br)cc1CNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14BrCl2NO/c1-2-7-21-16-6-3-12(17)8-11(16)10-20-13-4-5-14(18)15(19)9-13/h2-6,8-9,20H,1,7,10H2 |
| InChIKey | MVLKGJNQHDSHSI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|