C22H20ClFINO2 — CID 126121690
3-chloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-4-methylaniline (PubChem CID 126121690) has the molecular formula C22H20ClFINO2 and a molecular weight of 511.76 g/mol. Its IUPAC name is 3-chloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-4-methylaniline.
| Compound Name | 3-chloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-4-methylaniline |
|---|---|
| PubChem CID | 126121690 |
| Molecular Formula | C22H20ClFINO2 |
| Molecular Weight | 511.76 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 3-chloro-N-[[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-4-methylaniline |
| SMILES | COc1cc(CNc2ccc(C)c(Cl)c2)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C22H20ClFINO2/c1-14-7-8-17(11-18(14)23)26-12-15-9-20(25)22(21(10-15)27-2)28-13-16-5-3-4-6-19(16)24/h3-11,26H,12-13H2,1-2H3 |
| InChIKey | METWVMZEAIDDHW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|