C22H21ClINO2 — CID 126117400
N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-methylaniline (PubChem CID 126117400) has the molecular formula C22H21ClINO2 and a molecular weight of 493.77 g/mol. Its IUPAC name is N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-methylaniline.
| Compound Name | N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-methylaniline |
|---|---|
| PubChem CID | 126117400 |
| Molecular Formula | C22H21ClINO2 |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | N-[[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methyl]-3-methylaniline |
| SMILES | COc1cc(CNc2cccc(C)c2)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H21ClINO2/c1-15-6-5-8-18(10-15)25-13-16-11-20(24)22(21(12-16)26-2)27-14-17-7-3-4-9-19(17)23/h3-12,25H,13-14H2,1-2H3 |
| InChIKey | AFJVXZWKKMWRFR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|