C24H25IN2O3 — CID 126257833
2-[2-iodo-6-methoxy-4-[(3-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126257833) has the molecular formula C24H25IN2O3 and a molecular weight of 516.38 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(3-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(3-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126257833 |
| Molecular Formula | C24H25IN2O3 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(3-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(CNc2cccc(C)c2)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C24H25IN2O3/c1-16-6-4-8-19(10-16)26-14-18-12-21(25)24(22(13-18)29-3)30-15-23(28)27-20-9-5-7-17(2)11-20/h4-13,26H,14-15H2,1-3H3,(H,27,28) |
| InChIKey | QBRGCCIKZQNRGB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|