C23H27IN2O4S — CID 126274817
2-[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126274817) has the molecular formula C23H27IN2O4S and a molecular weight of 554.45 g/mol. Its IUPAC name is 2-[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126274817 |
| Molecular Formula | C23H27IN2O4S |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2-[4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-2-iodo-6-methoxyphenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | COc1cc(C(=S)N2C[C@@H](C)O[C@H](C)C2)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C23H27IN2O4S/c1-14-6-5-7-18(8-14)25-21(27)13-29-22-19(24)9-17(10-20(22)28-4)23(31)26-11-15(2)30-16(3)12-26/h5-10,15-16H,11-13H2,1-4H3,(H,25,27)/t15-,16-/m1/s1 |
| InChIKey | XCDLMXZFEYNLMC-HZPDHXFCSA-N |
| XLogP | 4.41 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|