C21H23IN2O3S — CID 126263104
2-[2-iodo-6-methoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-phenylacetamide (PubChem CID 126263104) has the molecular formula C21H23IN2O3S and a molecular weight of 510.40 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-iodo-6-methoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126263104 |
| Molecular Formula | C21H23IN2O3S |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-phenylacetamide |
| SMILES | COc1cc(C(=S)N2CCCCC2)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H23IN2O3S/c1-26-18-13-15(21(28)24-10-6-3-7-11-24)12-17(22)20(18)27-14-19(25)23-16-8-4-2-5-9-16/h2,4-5,8-9,12-13H,3,6-7,10-11,14H2,1H3,(H,23,25) |
| InChIKey | MUZIJZIRBOUHOV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|