C24H29IN2O3S — CID 126271903
2-[2-ethoxy-6-iodo-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 126271903) has the molecular formula C24H29IN2O3S and a molecular weight of 552.48 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-6-iodo-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126271903 |
| Molecular Formula | C24H29IN2O3S |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCOc1cc(C(=S)N2CCCC2)cc(I)c1OCC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H29IN2O3S/c1-5-29-20-13-18(24(31)27-8-6-7-9-27)12-19(25)23(20)30-14-21(28)26-22-16(3)10-15(2)11-17(22)4/h10-13H,5-9,14H2,1-4H3,(H,26,28) |
| InChIKey | OHESQXDCPAXKDA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|