C23H27IN2O3S — CID 126269116
2-[2-iodo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126269116) has the molecular formula C23H27IN2O3S and a molecular weight of 538.45 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-iodo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126269116 |
| Molecular Formula | C23H27IN2O3S |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-(4-methylpiperidine-1-carbothioyl)phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(C(=S)N2CCC(C)CC2)cc(I)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C23H27IN2O3S/c1-15-8-10-26(11-9-15)23(30)17-12-18(24)22(20(13-17)28-3)29-14-21(27)25-19-7-5-4-6-16(19)2/h4-7,12-13,15H,8-11,14H2,1-3H3,(H,25,27) |
| InChIKey | KUPCKFMWSOTYMM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|