C23H23IN2O3 — CID 126267141
2-[2-iodo-6-methoxy-4-[(2-methylanilino)methyl]phenoxy]-N-phenylacetamide (PubChem CID 126267141) has the molecular formula C23H23IN2O3 and a molecular weight of 502.35 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(2-methylanilino)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(2-methylanilino)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126267141 |
| Molecular Formula | C23H23IN2O3 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(2-methylanilino)methyl]phenoxy]-N-phenylacetamide |
| SMILES | COc1cc(CNc2ccccc2C)cc(I)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H23IN2O3/c1-16-8-6-7-11-20(16)25-14-17-12-19(24)23(21(13-17)28-2)29-15-22(27)26-18-9-4-3-5-10-18/h3-13,25H,14-15H2,1-2H3,(H,26,27) |
| InChIKey | ZCZMOYMSNOTCEE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|