C23H22Cl2N2O2 — CID 126261528
2-[2,6-dichloro-4-[(2,4-dimethylanilino)methyl]phenoxy]-N-phenylacetamide (PubChem CID 126261528) has the molecular formula C23H22Cl2N2O2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(2,4-dimethylanilino)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2,6-dichloro-4-[(2,4-dimethylanilino)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126261528 |
| Molecular Formula | C23H22Cl2N2O2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[2,6-dichloro-4-[(2,4-dimethylanilino)methyl]phenoxy]-N-phenylacetamide |
| SMILES | Cc1ccc(NCc2cc(Cl)c(OCC(=O)Nc3ccccc3)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C23H22Cl2N2O2/c1-15-8-9-21(16(2)10-15)26-13-17-11-19(24)23(20(25)12-17)29-14-22(28)27-18-6-4-3-5-7-18/h3-12,26H,13-14H2,1-2H3,(H,27,28) |
| InChIKey | HMCNAHYWUUPSGN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |