C22H22BrN3O3 — CID 169386318
2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]-N-phenylacetamide (PubChem CID 169386318) has the molecular formula C22H22BrN3O3 and a molecular weight of 456.34 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 169386318 |
| Molecular Formula | C22H22BrN3O3 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]-N-phenylacetamide |
| SMILES | COc1cc(CNNc2ccccc2)cc(Br)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H22BrN3O3/c1-28-20-13-16(14-24-26-18-10-6-3-7-11-18)12-19(23)22(20)29-15-21(27)25-17-8-4-2-5-9-17/h2-13,24,26H,14-15H2,1H3,(H,25,27) |
| InChIKey | MTMSGMVHPOQGRZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|