C18H21BrN2O4 — CID 169386451
methyl 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]propanoate (PubChem CID 169386451) has the molecular formula C18H21BrN2O4 and a molecular weight of 409.28 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]propanoate.
| Compound Name | methyl 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 169386451 |
| Molecular Formula | C18H21BrN2O4 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | methyl 2-[2-bromo-6-methoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1c(Br)cc(CNNc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H21BrN2O4/c1-12(18(22)24-3)25-17-15(19)9-13(10-16(17)23-2)11-20-21-14-7-5-4-6-8-14/h4-10,12,20-21H,11H2,1-3H3 |
| InChIKey | KAEIIHUTZYAKQF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|