C18H19BrFNO4 — CID 66527723
2-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propanoic acid (PubChem CID 66527723) has the molecular formula C18H19BrFNO4 and a molecular weight of 412.26 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propanoic acid.
| Compound Name | 2-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 66527723 |
| Molecular Formula | C18H19BrFNO4 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]propanoic acid |
| SMILES | COc1cc(CNC(C)C(=O)O)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C18H19BrFNO4/c1-11(18(22)23)21-9-12-7-14(19)17(16(8-12)24-2)25-10-13-5-3-4-6-15(13)20/h3-8,11,21H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | WKPLIMMRWCLFRV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |