C17H20N2O5 — CID 169385803
2-[2,6-dimethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetic acid (PubChem CID 169385803) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[2,6-dimethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dimethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 169385803 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[2,6-dimethoxy-4-[(2-phenylhydrazinyl)methyl]phenoxy]acetic acid |
| SMILES | COc1cc(CNNc2ccccc2)cc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C17H20N2O5/c1-22-14-8-12(10-18-19-13-6-4-3-5-7-13)9-15(23-2)17(14)24-11-16(20)21/h3-9,18-19H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | DWAVPTQJZBKMMF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|