C21H18Br2N2O2 — CID 126265061
2-[4-(anilinomethyl)-2,6-dibromophenoxy]-N-phenylacetamide (PubChem CID 126265061) has the molecular formula C21H18Br2N2O2 and a molecular weight of 490.20 g/mol. Its IUPAC name is 2-[4-(anilinomethyl)-2,6-dibromophenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-(anilinomethyl)-2,6-dibromophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126265061 |
| Molecular Formula | C21H18Br2N2O2 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 2-[4-(anilinomethyl)-2,6-dibromophenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1c(Br)cc(CNc2ccccc2)cc1Br)Nc1ccccc1 |
| InChI | InChI=1S/C21H18Br2N2O2/c22-18-11-15(13-24-16-7-3-1-4-8-16)12-19(23)21(18)27-14-20(26)25-17-9-5-2-6-10-17/h1-12,24H,13-14H2,(H,25,26) |
| InChIKey | VYYABAIPPKYNDS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |